C13H18N4O2 — CID 63579621
5-[(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]furan-3-carbohydrazide (PubChem CID 63579621) has the molecular formula C13H18N4O2 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-[(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]furan-3-carbohydrazide.
| Compound Name | 5-[(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 63579621 |
| Molecular Formula | C13H18N4O2 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 5-[(4-ethyl-3,5-dimethylpyrazol-1-yl)methyl]furan-3-carbohydrazide |
| SMILES | CCc1c(C)nn(Cc2cc(C(=O)NN)co2)c1C |
| InChI | InChI=1S/C13H18N4O2/c1-4-12-8(2)16-17(9(12)3)6-11-5-10(7-19-11)13(18)15-14/h5,7H,4,6,14H2,1-3H3,(H,15,18) |
| InChIKey | ORVAAJMGTQOJLG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 86.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|