C13H20ClN3OS — CID 63606669
4-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-3-methylpiperazin-2-one (PubChem CID 63606669) has the molecular formula C13H20ClN3OS and a molecular weight of 301.84 g/mol. Its IUPAC name is 4-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-3-methylpiperazin-2-one.
| Compound Name | 4-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-3-methylpiperazin-2-one |
|---|---|
| PubChem CID | 63606669 |
| Molecular Formula | C13H20ClN3OS |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 4-[4-[4-(chloromethyl)-1,3-thiazol-2-yl]butyl]-3-methylpiperazin-2-one |
| SMILES | CC1C(=O)NCCN1CCCCc1nc(CCl)cs1 |
| InChI | InChI=1S/C13H20ClN3OS/c1-10-13(18)15-5-7-17(10)6-3-2-4-12-16-11(8-14)9-19-12/h9-10H,2-8H2,1H3,(H,15,18) |
| InChIKey | YYHQNWMPLVAIAS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|