C15H12F3N7O2 — CID 6364015
(1Z)-N-[[5-(methylcarbamoyl)-1H-imidazol-4-yl]amino]-2-oxo-2-[3-(trifluoromethyl)anilino]ethanimidoyl cyanide (PubChem CID 6364015) has the molecular formula C15H12F3N7O2 and a molecular weight of 379.30 g/mol. Its IUPAC name is (1Z)-N-[[5-(methylcarbamoyl)-1H-imidazol-4-yl]amino]-2-oxo-2-[3-(trifluoromethyl)anilino]ethanimidoyl cyanide.
| Compound Name | (1Z)-N-[[5-(methylcarbamoyl)-1H-imidazol-4-yl]amino]-2-oxo-2-[3-(trifluoromethyl)anilino]ethanimidoyl cyanide |
|---|---|
| PubChem CID | 6364015 |
| Molecular Formula | C15H12F3N7O2 |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | (1Z)-N-[[5-(methylcarbamoyl)-1H-imidazol-4-yl]amino]-2-oxo-2-[3-(trifluoromethyl)anilino]ethanimidoyl cyanide |
| SMILES | CNC(=O)c1[nH]cnc1N/N=C(/C#N)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F3N7O2/c1-20-14(27)11-12(22-7-21-11)25-24-10(6-19)13(26)23-9-4-2-3-8(5-9)15(16,17)18/h2-5,7,25H,1H3,(H,20,27)(H,21,22)(H,23,26)/b24-10- |
| InChIKey | GJBFGWXTYIQODJ-VROXFSQNSA-N |
| XLogP | 1.72 |
| TPSA | 135.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|