C27H31NO3 — CID 6365587
1-(benzhydrylamino)-3-[2-ethoxy-5-[(E)-prop-1-enyl]phenoxy]propan-2-ol (PubChem CID 6365587) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-(benzhydrylamino)-3-[2-ethoxy-5-[(E)-prop-1-enyl]phenoxy]propan-2-ol.
| Compound Name | 1-(benzhydrylamino)-3-[2-ethoxy-5-[(E)-prop-1-enyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 6365587 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 1-(benzhydrylamino)-3-[2-ethoxy-5-[(E)-prop-1-enyl]phenoxy]propan-2-ol |
| SMILES | C/C=C/c1ccc(OCC)c(OCC(O)CNC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C27H31NO3/c1-3-11-21-16-17-25(30-4-2)26(18-21)31-20-24(29)19-28-27(22-12-7-5-8-13-22)23-14-9-6-10-15-23/h3,5-18,24,27-29H,4,19-20H2,1-2H3/b11-3+ |
| InChIKey | WQTKWGUIFPHNPG-QDEBKDIKSA-N |
| XLogP | 5.24 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |