C24H30N3O2+ — CID 6365921
2-[(E)-2-cyano-3-[4-(1-phenylpropylamino)phenyl]prop-2-enoyl]oxyethyl-trimethylazanium (PubChem CID 6365921) has the molecular formula C24H30N3O2+ and a molecular weight of 392.52 g/mol. Its IUPAC name is 2-[(E)-2-cyano-3-[4-(1-phenylpropylamino)phenyl]prop-2-enoyl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(E)-2-cyano-3-[4-(1-phenylpropylamino)phenyl]prop-2-enoyl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 6365921 |
| Molecular Formula | C24H30N3O2+ |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-[(E)-2-cyano-3-[4-(1-phenylpropylamino)phenyl]prop-2-enoyl]oxyethyl-trimethylazanium |
| SMILES | CCC(Nc1ccc(/C=C(\C#N)C(=O)OCC[N+](C)(C)C)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H29N3O2/c1-5-23(20-9-7-6-8-10-20)26-22-13-11-19(12-14-22)17-21(18-25)24(28)29-16-15-27(2,3)4/h6-14,17,23H,5,15-16H2,1-4H3/p+1 |
| InChIKey | PUIFFHFELDLOPX-UHFFFAOYSA-O |
| XLogP | 4.41 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|