C11H8FN3S — CID 63674295
5-fluoro-2-(1,3-thiazol-2-ylmethylamino)benzonitrile (PubChem CID 63674295) has the molecular formula C11H8FN3S and a molecular weight of 233.27 g/mol. Its IUPAC name is 5-fluoro-2-(1,3-thiazol-2-ylmethylamino)benzonitrile.
| Compound Name | 5-fluoro-2-(1,3-thiazol-2-ylmethylamino)benzonitrile |
|---|---|
| PubChem CID | 63674295 |
| Molecular Formula | C11H8FN3S |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 5-fluoro-2-(1,3-thiazol-2-ylmethylamino)benzonitrile |
| SMILES | N#Cc1cc(F)ccc1NCc1nccs1 |
| InChI | InChI=1S/C11H8FN3S/c12-9-1-2-10(8(5-9)6-13)15-7-11-14-3-4-16-11/h1-5,15H,7H2 |
| InChIKey | CODRVDFBORDROI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |