C20H21FN2O2 — CID 6369812
1-[(E)-3-(azepan-1-yl)-1-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]pyridin-2-one (PubChem CID 6369812) has the molecular formula C20H21FN2O2 and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-[(E)-3-(azepan-1-yl)-1-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]pyridin-2-one.
| Compound Name | 1-[(E)-3-(azepan-1-yl)-1-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 6369812 |
| Molecular Formula | C20H21FN2O2 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[(E)-3-(azepan-1-yl)-1-(4-fluorophenyl)-3-oxoprop-1-en-2-yl]pyridin-2-one |
| SMILES | O=C(/C(=C\c1ccc(F)cc1)n1ccccc1=O)N1CCCCCC1 |
| InChI | InChI=1S/C20H21FN2O2/c21-17-10-8-16(9-11-17)15-18(23-14-6-3-7-19(23)24)20(25)22-12-4-1-2-5-13-22/h3,6-11,14-15H,1-2,4-5,12-13H2/b18-15+ |
| InChIKey | RTFAYIFSCQJFGG-OBGWFSINSA-N |
| XLogP | 3.39 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|