C19H22N3O2+ — CID 7278093
1-[(E)-3-(4-methylpiperazin-4-ium-1-yl)-3-oxo-1-phenylprop-1-en-2-yl]pyridin-2-one (PubChem CID 7278093) has the molecular formula C19H22N3O2+ and a molecular weight of 324.40 g/mol. Its IUPAC name is 1-[(E)-3-(4-methylpiperazin-4-ium-1-yl)-3-oxo-1-phenylprop-1-en-2-yl]pyridin-2-one.
| Compound Name | 1-[(E)-3-(4-methylpiperazin-4-ium-1-yl)-3-oxo-1-phenylprop-1-en-2-yl]pyridin-2-one |
|---|---|
| PubChem CID | 7278093 |
| Molecular Formula | C19H22N3O2+ |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-[(E)-3-(4-methylpiperazin-4-ium-1-yl)-3-oxo-1-phenylprop-1-en-2-yl]pyridin-2-one |
| SMILES | C[NH+]1CCN(C(=O)/C(=C\c2ccccc2)n2ccccc2=O)CC1 |
| InChI | InChI=1S/C19H21N3O2/c1-20-11-13-21(14-12-20)19(24)17(15-16-7-3-2-4-8-16)22-10-6-5-9-18(22)23/h2-10,15H,11-14H2,1H3/p+1/b17-15+ |
| InChIKey | BDILTLAYIKAUTI-BMRADRMJSA-O |
| XLogP | 0.20 |
| TPSA | 46.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|