C10H8N2OS2 — CID 6372477
(5Z)-2-sulfanylidene-5-[(E)-3-thiophen-2-ylprop-2-enylidene]imidazolidin-4-one (PubChem CID 6372477) has the molecular formula C10H8N2OS2 and a molecular weight of 236.32 g/mol. Its IUPAC name is (5Z)-2-sulfanylidene-5-[(E)-3-thiophen-2-ylprop-2-enylidene]imidazolidin-4-one.
| Compound Name | (5Z)-2-sulfanylidene-5-[(E)-3-thiophen-2-ylprop-2-enylidene]imidazolidin-4-one |
|---|---|
| PubChem CID | 6372477 |
| Molecular Formula | C10H8N2OS2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.01 |
| IUPAC Name | (5Z)-2-sulfanylidene-5-[(E)-3-thiophen-2-ylprop-2-enylidene]imidazolidin-4-one |
| SMILES | O=C1NC(=S)N/C1=C\C=C\c1cccs1 |
| InChI | InChI=1S/C10H8N2OS2/c13-9-8(11-10(14)12-9)5-1-3-7-4-2-6-15-7/h1-6H,(H2,11,12,13,14)/b3-1+,8-5- |
| InChIKey | YIHJBZHRLIWTTP-ZWGQKFFPSA-N |
| XLogP | 1.65 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|