C10H13N5OS3 — CID 63736840
3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]thiophene-2-carbohydrazide (PubChem CID 63736840) has the molecular formula C10H13N5OS3 and a molecular weight of 315.45 g/mol. Its IUPAC name is 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]thiophene-2-carbohydrazide.
| Compound Name | 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 63736840 |
| Molecular Formula | C10H13N5OS3 |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 3-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]thiophene-2-carbohydrazide |
| SMILES | CN(C)c1nnc(SCc2ccsc2C(=O)NN)s1 |
| InChI | InChI=1S/C10H13N5OS3/c1-15(2)9-13-14-10(19-9)18-5-6-3-4-17-7(6)8(16)12-11/h3-4H,5,11H2,1-2H3,(H,12,16) |
| InChIKey | IATWEFITJQTJHM-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|