C13H15N3OS2 — CID 79141449
3-[(5-amino-2-methylphenyl)sulfanylmethyl]thiophene-2-carbohydrazide (PubChem CID 79141449) has the molecular formula C13H15N3OS2 and a molecular weight of 293.42 g/mol. Its IUPAC name is 3-[(5-amino-2-methylphenyl)sulfanylmethyl]thiophene-2-carbohydrazide.
| Compound Name | 3-[(5-amino-2-methylphenyl)sulfanylmethyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 79141449 |
| Molecular Formula | C13H15N3OS2 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 3-[(5-amino-2-methylphenyl)sulfanylmethyl]thiophene-2-carbohydrazide |
| SMILES | Cc1ccc(N)cc1SCc1ccsc1C(=O)NN |
| InChI | InChI=1S/C13H15N3OS2/c1-8-2-3-10(14)6-11(8)19-7-9-4-5-18-12(9)13(17)16-15/h2-6H,7,14-15H2,1H3,(H,16,17) |
| InChIKey | JYOWSEVOJOMDGL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|