C9H14N2O3S2 — CID 79671984
3-(2,3-dihydroxypropylsulfanylmethyl)thiophene-2-carbohydrazide (PubChem CID 79671984) has the molecular formula C9H14N2O3S2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropylsulfanylmethyl)thiophene-2-carbohydrazide.
| Compound Name | 3-(2,3-dihydroxypropylsulfanylmethyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 79671984 |
| Molecular Formula | C9H14N2O3S2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 3-(2,3-dihydroxypropylsulfanylmethyl)thiophene-2-carbohydrazide |
| SMILES | NNC(=O)c1sccc1CSCC(O)CO |
| InChI | InChI=1S/C9H14N2O3S2/c10-11-9(14)8-6(1-2-16-8)4-15-5-7(13)3-12/h1-2,7,12-13H,3-5,10H2,(H,11,14) |
| InChIKey | BNLOWUSMKRHVIT-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|