C10H17N3OS2 — CID 66231446
3-(2-aminobutylsulfanylmethyl)thiophene-2-carbohydrazide (PubChem CID 66231446) has the molecular formula C10H17N3OS2 and a molecular weight of 259.40 g/mol. Its IUPAC name is 3-(2-aminobutylsulfanylmethyl)thiophene-2-carbohydrazide.
| Compound Name | 3-(2-aminobutylsulfanylmethyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 66231446 |
| Molecular Formula | C10H17N3OS2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 3-(2-aminobutylsulfanylmethyl)thiophene-2-carbohydrazide |
| SMILES | CCC(N)CSCc1ccsc1C(=O)NN |
| InChI | InChI=1S/C10H17N3OS2/c1-2-8(11)6-15-5-7-3-4-16-9(7)10(14)13-12/h3-4,8H,2,5-6,11-12H2,1H3,(H,13,14) |
| InChIKey | VECGEYYNYVNHOI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|