C14H15N3OS2 — CID 63737154
3-[4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]phenyl]prop-2-yn-1-ol (PubChem CID 63737154) has the molecular formula C14H15N3OS2 and a molecular weight of 305.43 g/mol. Its IUPAC name is 3-[4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 63737154 |
| Molecular Formula | C14H15N3OS2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-[4-[[5-(dimethylamino)-1,3,4-thiadiazol-2-yl]sulfanylmethyl]phenyl]prop-2-yn-1-ol |
| SMILES | CN(C)c1nnc(SCc2ccc(C#CCO)cc2)s1 |
| InChI | InChI=1S/C14H15N3OS2/c1-17(2)13-15-16-14(20-13)19-10-12-7-5-11(6-8-12)4-3-9-18/h5-8,18H,9-10H2,1-2H3 |
| InChIKey | FWTPEIVKXMDKAT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|