C13H14F3N3 — CID 63744916
6-N,6-N,3-trimethyl-2-(trifluoromethyl)quinoline-4,6-diamine (PubChem CID 63744916) has the molecular formula C13H14F3N3 and a molecular weight of 269.27 g/mol. Its IUPAC name is 6-N,6-N,3-trimethyl-2-(trifluoromethyl)quinoline-4,6-diamine.
| Compound Name | 6-N,6-N,3-trimethyl-2-(trifluoromethyl)quinoline-4,6-diamine |
|---|---|
| PubChem CID | 63744916 |
| Molecular Formula | C13H14F3N3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 6-N,6-N,3-trimethyl-2-(trifluoromethyl)quinoline-4,6-diamine |
| SMILES | Cc1c(C(F)(F)F)nc2ccc(N(C)C)cc2c1N |
| InChI | InChI=1S/C13H14F3N3/c1-7-11(17)9-6-8(19(2)3)4-5-10(9)18-12(7)13(14,15)16/h4-6H,1-3H3,(H2,17,18) |
| InChIKey | IMGDBUPAOCZJIW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |