C11H11N3OS — CID 6374665
(1Z)-1-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylurea (PubChem CID 6374665) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is (1Z)-1-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylurea.
| Compound Name | (1Z)-1-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylurea |
|---|---|
| PubChem CID | 6374665 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | (1Z)-1-(3-methyl-1,3-thiazol-2-ylidene)-3-phenylurea |
| SMILES | Cn1ccs/c1=N\C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H11N3OS/c1-14-7-8-16-11(14)13-10(15)12-9-5-3-2-4-6-9/h2-8H,1H3,(H,12,15)/b13-11- |
| InChIKey | KWALDNQIQIFHQI-QBFSEMIESA-N |
| XLogP | 2.22 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |