C14H16N4OS2 — CID 63749555
N-(4-tert-butyl-1,3-thiazol-2-yl)-5-carbamothioylpyridine-2-carboxamide (PubChem CID 63749555) has the molecular formula C14H16N4OS2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-(4-tert-butyl-1,3-thiazol-2-yl)-5-carbamothioylpyridine-2-carboxamide.
| Compound Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-5-carbamothioylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 63749555 |
| Molecular Formula | C14H16N4OS2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | N-(4-tert-butyl-1,3-thiazol-2-yl)-5-carbamothioylpyridine-2-carboxamide |
| SMILES | CC(C)(C)c1csc(NC(=O)c2ccc(C(N)=S)cn2)n1 |
| InChI | InChI=1S/C14H16N4OS2/c1-14(2,3)10-7-21-13(17-10)18-12(19)9-5-4-8(6-16-9)11(15)20/h4-7H,1-3H3,(H2,15,20)(H,17,18,19) |
| InChIKey | GNEOHKFZQVCFMG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|