C11H12ClN3OS — CID 63769891
3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-2,6-dimethylpyrimidin-4-one (PubChem CID 63769891) has the molecular formula C11H12ClN3OS and a molecular weight of 269.76 g/mol. Its IUPAC name is 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-2,6-dimethylpyrimidin-4-one.
| Compound Name | 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 63769891 |
| Molecular Formula | C11H12ClN3OS |
| Molecular Weight | 269.76 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 3-[[4-(chloromethyl)-1,3-thiazol-2-yl]methyl]-2,6-dimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(Cc2nc(CCl)cs2)c(C)n1 |
| InChI | InChI=1S/C11H12ClN3OS/c1-7-3-11(16)15(8(2)13-7)5-10-14-9(4-12)6-17-10/h3,6H,4-5H2,1-2H3 |
| InChIKey | KPLJXIRWJAJMDX-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.76 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|