C15H16N2O — CID 63772321
1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)pyrazole-4-carbaldehyde (PubChem CID 63772321) has the molecular formula C15H16N2O and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)pyrazole-4-carbaldehyde.
| Compound Name | 1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 63772321 |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | 1-(1,2,3,4-tetrahydronaphthalen-1-ylmethyl)pyrazole-4-carbaldehyde |
| SMILES | O=Cc1cnn(CC2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C15H16N2O/c18-11-12-8-16-17(9-12)10-14-6-3-5-13-4-1-2-7-15(13)14/h1-2,4,7-9,11,14H,3,5-6,10H2 |
| InChIKey | UUCNEHXNFZISIK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|