C10H7Cl2NO3 — CID 63777220
4-(2,3-dichlorophenyl)morpholine-2,6-dione (PubChem CID 63777220) has the molecular formula C10H7Cl2NO3 and a molecular weight of 260.08 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)morpholine-2,6-dione.
| Compound Name | 4-(2,3-dichlorophenyl)morpholine-2,6-dione |
|---|---|
| PubChem CID | 63777220 |
| Molecular Formula | C10H7Cl2NO3 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 4-(2,3-dichlorophenyl)morpholine-2,6-dione |
| SMILES | O=C1CN(c2cccc(Cl)c2Cl)CC(=O)O1 |
| InChI | InChI=1S/C10H7Cl2NO3/c11-6-2-1-3-7(10(6)12)13-4-8(14)16-9(15)5-13/h1-3H,4-5H2 |
| InChIKey | XUXODKBNFBLCBX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|