C10H8Cl2N2O — CID 156762824
4-(2,3-dichlorophenyl)-1,3-dihydropyrazin-2-one (PubChem CID 156762824) has the molecular formula C10H8Cl2N2O and a molecular weight of 243.09 g/mol. Its IUPAC name is 4-(2,3-dichlorophenyl)-1,3-dihydropyrazin-2-one.
| Compound Name | 4-(2,3-dichlorophenyl)-1,3-dihydropyrazin-2-one |
|---|---|
| PubChem CID | 156762824 |
| Molecular Formula | C10H8Cl2N2O |
| Molecular Weight | 243.09 g/mol |
| Exact Mass | 242.00 |
| IUPAC Name | 4-(2,3-dichlorophenyl)-1,3-dihydropyrazin-2-one |
| SMILES | O=C1CN(c2cccc(Cl)c2Cl)C=CN1 |
| InChI | InChI=1S/C10H8Cl2N2O/c11-7-2-1-3-8(10(7)12)14-5-4-13-9(15)6-14/h1-5H,6H2,(H,13,15) |
| InChIKey | QYNVZZQCXPULJP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.09 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |