C12H14N4OS3 — CID 63812837
2-methoxy-N-[[6-(1,3-thiazol-2-ylsulfanyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine (PubChem CID 63812837) has the molecular formula C12H14N4OS3 and a molecular weight of 326.47 g/mol. Its IUPAC name is 2-methoxy-N-[[6-(1,3-thiazol-2-ylsulfanyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[6-(1,3-thiazol-2-ylsulfanyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 63812837 |
| Molecular Formula | C12H14N4OS3 |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 2-methoxy-N-[[6-(1,3-thiazol-2-ylsulfanyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine |
| SMILES | COCCNCc1c(Sc2nccs2)nc2sccn12 |
| InChI | InChI=1S/C12H14N4OS3/c1-17-5-2-13-8-9-10(20-12-14-3-6-19-12)15-11-16(9)4-7-18-11/h3-4,6-7,13H,2,5,8H2,1H3 |
| InChIKey | YEKYPWVPKYGEAM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|