C14H15F2N3S — CID 63814637
N-[(3,5-difluoro-4-pyrimidin-4-ylsulfanylphenyl)methyl]propan-1-amine (PubChem CID 63814637) has the molecular formula C14H15F2N3S and a molecular weight of 295.36 g/mol. Its IUPAC name is N-[(3,5-difluoro-4-pyrimidin-4-ylsulfanylphenyl)methyl]propan-1-amine.
| Compound Name | N-[(3,5-difluoro-4-pyrimidin-4-ylsulfanylphenyl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 63814637 |
| Molecular Formula | C14H15F2N3S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | N-[(3,5-difluoro-4-pyrimidin-4-ylsulfanylphenyl)methyl]propan-1-amine |
| SMILES | CCCNCc1cc(F)c(Sc2ccncn2)c(F)c1 |
| InChI | InChI=1S/C14H15F2N3S/c1-2-4-17-8-10-6-11(15)14(12(16)7-10)20-13-3-5-18-9-19-13/h3,5-7,9,17H,2,4,8H2,1H3 |
| InChIKey | ZWYJLZRELRALPB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|