C9H13N3OS — CID 63824639
4-amino-1-[2-(1,3-thiazol-4-yl)ethyl]pyrrolidin-2-one (PubChem CID 63824639) has the molecular formula C9H13N3OS and a molecular weight of 211.29 g/mol. Its IUPAC name is 4-amino-1-[2-(1,3-thiazol-4-yl)ethyl]pyrrolidin-2-one.
| Compound Name | 4-amino-1-[2-(1,3-thiazol-4-yl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 63824639 |
| Molecular Formula | C9H13N3OS |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 4-amino-1-[2-(1,3-thiazol-4-yl)ethyl]pyrrolidin-2-one |
| SMILES | NC1CC(=O)N(CCc2cscn2)C1 |
| InChI | InChI=1S/C9H13N3OS/c10-7-3-9(13)12(4-7)2-1-8-5-14-6-11-8/h5-7H,1-4,10H2 |
| InChIKey | BQHUVTTWNQONNI-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |