C11H11N5O4S — CID 6383181
2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-1-(5-nitrofuran-2-yl)ethylideneamino]acetamide (PubChem CID 6383181) has the molecular formula C11H11N5O4S and a molecular weight of 309.31 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-1-(5-nitrofuran-2-yl)ethylideneamino]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-1-(5-nitrofuran-2-yl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 6383181 |
| Molecular Formula | C11H11N5O4S |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[(Z)-1-(5-nitrofuran-2-yl)ethylideneamino]acetamide |
| SMILES | C/C(=N/NC(=O)Cc1csc(N)n1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C11H11N5O4S/c1-6(8-2-3-10(20-8)16(18)19)14-15-9(17)4-7-5-21-11(12)13-7/h2-3,5H,4H2,1H3,(H2,12,13)(H,15,17)/b14-6- |
| InChIKey | NOFAMXSMMMONLA-NSIKDUERSA-N |
| XLogP | 1.31 |
| TPSA | 136.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|