C15H39IrN3O2P3+6 — CID 6383581
[2-(1H-imidazol-5-yl)-1-oxoniocarbonylethyl]azanide;iridium(3+);tris(trimethylphosphanium) (PubChem CID 6383581) has the molecular formula C15H39IrN3O2P3+6 and a molecular weight of 578.64 g/mol. Its IUPAC name is [2-(1H-imidazol-5-yl)-1-oxoniocarbonylethyl]azanide;iridium(3+);tris(trimethylphosphanium).
| Compound Name | [2-(1H-imidazol-5-yl)-1-oxoniocarbonylethyl]azanide;iridium(3+);tris(trimethylphosphanium) |
|---|---|
| PubChem CID | 6383581 |
| Molecular Formula | C15H39IrN3O2P3+6 |
| Molecular Weight | 578.64 g/mol |
| Exact Mass | 579.19 |
| IUPAC Name | [2-(1H-imidazol-5-yl)-1-oxoniocarbonylethyl]azanide;iridium(3+);tris(trimethylphosphanium) |
| SMILES | C[PH+](C)C.C[PH+](C)C.C[PH+](C)C.[Ir+3].[NH-]C(Cc1cnc[nH]1)C(=O)[OH2+] |
| InChI | InChI=1S/C6H8N3O2.3C3H9P.Ir/c7-5(6(10)11)1-4-2-8-3-9-4;3*1-4(2)3;/h2-3,5,7H,1H2,(H,8,9)(H,10,11);3*1-3H3;/q-1;;;;+3/p+4 |
| InChIKey | YQYHTYLWXLQKRD-UHFFFAOYSA-R |
| XLogP | 2.89 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.64 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|