C10H17ClN2OS — CID 63856992
5-chloro-4-(3-methoxypropylsulfanylmethyl)-1,3-dimethylpyrazole (PubChem CID 63856992) has the molecular formula C10H17ClN2OS and a molecular weight of 248.78 g/mol. Its IUPAC name is 5-chloro-4-(3-methoxypropylsulfanylmethyl)-1,3-dimethylpyrazole.
| Compound Name | 5-chloro-4-(3-methoxypropylsulfanylmethyl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 63856992 |
| Molecular Formula | C10H17ClN2OS |
| Molecular Weight | 248.78 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5-chloro-4-(3-methoxypropylsulfanylmethyl)-1,3-dimethylpyrazole |
| SMILES | COCCCSCc1c(C)nn(C)c1Cl |
| InChI | InChI=1S/C10H17ClN2OS/c1-8-9(10(11)13(2)12-8)7-15-6-4-5-14-3/h4-7H2,1-3H3 |
| InChIKey | JOKBGWPJBPDMTA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|