C13H21BrN4O2S — CID 63896855
2-amino-4-bromo-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide (PubChem CID 63896855) has the molecular formula C13H21BrN4O2S and a molecular weight of 377.31 g/mol. Its IUPAC name is 2-amino-4-bromo-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 2-amino-4-bromo-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63896855 |
| Molecular Formula | C13H21BrN4O2S |
| Molecular Weight | 377.31 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-amino-4-bromo-N-[(1,4-dimethylpiperazin-2-yl)methyl]benzenesulfonamide |
| SMILES | CN1CCN(C)C(CNS(=O)(=O)c2ccc(Br)cc2N)C1 |
| InChI | InChI=1S/C13H21BrN4O2S/c1-17-5-6-18(2)11(9-17)8-16-21(19,20)13-4-3-10(14)7-12(13)15/h3-4,7,11,16H,5-6,8-9,15H2,1-2H3 |
| InChIKey | OSNOIUXGHRCCRB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|