C11H16N2O6S2 — CID 63922118
4-[(1,1-dioxothian-3-yl)sulfamoyl]-1-methylpyrrole-2-carboxylic acid (PubChem CID 63922118) has the molecular formula C11H16N2O6S2 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-[(1,1-dioxothian-3-yl)sulfamoyl]-1-methylpyrrole-2-carboxylic acid.
| Compound Name | 4-[(1,1-dioxothian-3-yl)sulfamoyl]-1-methylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 63922118 |
| Molecular Formula | C11H16N2O6S2 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 4-[(1,1-dioxothian-3-yl)sulfamoyl]-1-methylpyrrole-2-carboxylic acid |
| SMILES | Cn1cc(S(=O)(=O)NC2CCCS(=O)(=O)C2)cc1C(=O)O |
| InChI | InChI=1S/C11H16N2O6S2/c1-13-6-9(5-10(13)11(14)15)21(18,19)12-8-3-2-4-20(16,17)7-8/h5-6,8,12H,2-4,7H2,1H3,(H,14,15) |
| InChIKey | PZQNOQMOCVWFDD-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |