C8H14F3NO2S — CID 63923042
1,1-dioxo-N-(3,3,3-trifluoropropyl)thian-3-amine (PubChem CID 63923042) has the molecular formula C8H14F3NO2S and a molecular weight of 245.27 g/mol. Its IUPAC name is 1,1-dioxo-N-(3,3,3-trifluoropropyl)thian-3-amine.
| Compound Name | 1,1-dioxo-N-(3,3,3-trifluoropropyl)thian-3-amine |
|---|---|
| PubChem CID | 63923042 |
| Molecular Formula | C8H14F3NO2S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | 1,1-dioxo-N-(3,3,3-trifluoropropyl)thian-3-amine |
| SMILES | O=S1(=O)CCCC(NCCC(F)(F)F)C1 |
| InChI | InChI=1S/C8H14F3NO2S/c9-8(10,11)3-4-12-7-2-1-5-15(13,14)6-7/h7,12H,1-6H2 |
| InChIKey | ZLELYPXHGTXCCW-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |