C14H25N3O — CID 63954273
2-methoxy-N-[(6-propyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)methyl]ethanamine (PubChem CID 63954273) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-methoxy-N-[(6-propyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)methyl]ethanamine.
| Compound Name | 2-methoxy-N-[(6-propyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 63954273 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2-methoxy-N-[(6-propyl-4,5,6,7-tetrahydro-1H-benzimidazol-2-yl)methyl]ethanamine |
| SMILES | CCCC1CCc2nc(CNCCOC)[nH]c2C1 |
| InChI | InChI=1S/C14H25N3O/c1-3-4-11-5-6-12-13(9-11)17-14(16-12)10-15-7-8-18-2/h11,15H,3-10H2,1-2H3,(H,16,17) |
| InChIKey | MGYYOVGIPQRIIQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|