About 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one
2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one (PubChem CID 63986631) has the molecular formula C11H9N3OS
and a molecular weight of 231.28 g/mol. Its IUPAC name is 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one.
Molecular Properties
| Compound Name | 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| PubChem CID | 63986631 |
| Molecular Formula | C11H9N3OS |
| Molecular Weight | 231.28 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| SMILES | O=C1CCCc2nc(-c3ccncn3)sc21 |
| InChI | InChI=1S/C11H9N3OS/c15-9-3-1-2-7-10(9)16-11(14-7)8-4-5-12-6-13-8/h4-6H,1-3H2 |
| InChIKey | IXPIPOLBHSABMT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The IUPAC name of 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one (CID 63986631) is 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one.
What is the SMILES notation for 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The canonical SMILES for 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one is O=C1CCCc2nc(-c3ccncn3)sc21.
What is the InChIKey of 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one?
The InChIKey is IXPIPOLBHSABMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3OS/c15-9-3-1-2-7-10(9)16-11(14-7)8-4-5-12-6-13-8/h4-6H,1-3H2.
What are the key properties of 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one?
2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one has a molecular weight of 231.28 g/mol, XLogP of 2.12, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrimidin-4-yl-5,6-dihydro-4H-1,3-benzothiazol-7-one is sourced from PubChem (CID 63986631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).