C19H14N4O3S — CID 6413433
(E)-3-(4-methoxyphenyl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)prop-2-enoic acid (PubChem CID 6413433) has the molecular formula C19H14N4O3S and a molecular weight of 378.41 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)prop-2-enoic acid.
| Compound Name | (E)-3-(4-methoxyphenyl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 6413433 |
| Molecular Formula | C19H14N4O3S |
| Molecular Weight | 378.41 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-2-(5H-[1,2,4]triazino[5,6-b]indol-3-ylsulfanyl)prop-2-enoic acid |
| SMILES | COc1ccc(/C=C(/Sc2nnc3c(n2)[nH]c2ccccc23)C(=O)O)cc1 |
| InChI | InChI=1S/C19H14N4O3S/c1-26-12-8-6-11(7-9-12)10-15(18(24)25)27-19-21-17-16(22-23-19)13-4-2-3-5-14(13)20-17/h2-10H,1H3,(H,24,25)(H,20,21,23)/b15-10+ |
| InChIKey | ZTALLBWFJHCSAX-XNTDXEJSSA-N |
| XLogP | 3.73 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|