C21H20N4O2S — CID 6414174
N-(2-acetylphenyl)-2-[(6-phenyl-1,2,4-triazin-3-yl)sulfanyl]butanamide (PubChem CID 6414174) has the molecular formula C21H20N4O2S and a molecular weight of 392.48 g/mol. Its IUPAC name is N-(2-acetylphenyl)-2-[(6-phenyl-1,2,4-triazin-3-yl)sulfanyl]butanamide.
| Compound Name | N-(2-acetylphenyl)-2-[(6-phenyl-1,2,4-triazin-3-yl)sulfanyl]butanamide |
|---|---|
| PubChem CID | 6414174 |
| Molecular Formula | C21H20N4O2S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | N-(2-acetylphenyl)-2-[(6-phenyl-1,2,4-triazin-3-yl)sulfanyl]butanamide |
| SMILES | CCC(Sc1ncc(-c2ccccc2)nn1)C(=O)Nc1ccccc1C(C)=O |
| InChI | InChI=1S/C21H20N4O2S/c1-3-19(20(27)23-17-12-8-7-11-16(17)14(2)26)28-21-22-13-18(24-25-21)15-9-5-4-6-10-15/h4-13,19H,3H2,1-2H3,(H,23,27) |
| InChIKey | HUDDNSBJQPJBPP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |