C15H15Cl2N4O+ — CID 6414500
1-[(2,4-dichlorophenyl)methyl]-7-ethyl-6-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-8-one (PubChem CID 6414500) has the molecular formula C15H15Cl2N4O+ and a molecular weight of 338.22 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-7-ethyl-6-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-8-one.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-7-ethyl-6-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-8-one |
|---|---|
| PubChem CID | 6414500 |
| Molecular Formula | C15H15Cl2N4O+ |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-7-ethyl-6-methyl-5H-[1,2,4]triazolo[4,3-b]pyridazin-4-ium-8-one |
| SMILES | CCc1c(C)[nH][n+]2cnn(Cc3ccc(Cl)cc3Cl)c2c1=O |
| InChI | InChI=1S/C15H14Cl2N4O/c1-3-12-9(2)19-21-8-18-20(15(21)14(12)22)7-10-4-5-11(16)6-13(10)17/h4-6,8H,3,7H2,1-2H3/p+1 |
| InChIKey | QHIUKNXHLSHXRY-UHFFFAOYSA-O |
| XLogP | 2.54 |
| TPSA | 54.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|