C21H22N6O4S — CID 6416838
N-[8-(diethylsulfamoyl)-5H-[1,2,4]triazino[5,6-b]indol-3-yl]-4-methoxybenzamide (PubChem CID 6416838) has the molecular formula C21H22N6O4S and a molecular weight of 454.51 g/mol. Its IUPAC name is N-[8-(diethylsulfamoyl)-5H-[1,2,4]triazino[5,6-b]indol-3-yl]-4-methoxybenzamide.
| Compound Name | N-[8-(diethylsulfamoyl)-5H-[1,2,4]triazino[5,6-b]indol-3-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 6416838 |
| Molecular Formula | C21H22N6O4S |
| Molecular Weight | 454.51 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | N-[8-(diethylsulfamoyl)-5H-[1,2,4]triazino[5,6-b]indol-3-yl]-4-methoxybenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2[nH]c3nc(NC(=O)c4ccc(OC)cc4)nnc3c2c1 |
| InChI | InChI=1S/C21H22N6O4S/c1-4-27(5-2)32(29,30)15-10-11-17-16(12-15)18-19(22-17)23-21(26-25-18)24-20(28)13-6-8-14(31-3)9-7-13/h6-12H,4-5H2,1-3H3,(H2,22,23,24,26,28) |
| InChIKey | ZXJDNMYCKVHMIC-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.51 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |