C23H24N6O3S — CID 6416984
N-(5-ethyl-8-piperidin-1-ylsulfonyl-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide (PubChem CID 6416984) has the molecular formula C23H24N6O3S and a molecular weight of 464.55 g/mol. Its IUPAC name is N-(5-ethyl-8-piperidin-1-ylsulfonyl-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide.
| Compound Name | N-(5-ethyl-8-piperidin-1-ylsulfonyl-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide |
|---|---|
| PubChem CID | 6416984 |
| Molecular Formula | C23H24N6O3S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | N-(5-ethyl-8-piperidin-1-ylsulfonyl-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide |
| SMILES | CCn1c2ccc(S(=O)(=O)N3CCCCC3)cc2c2nnc(NC(=O)c3ccccc3)nc21 |
| InChI | InChI=1S/C23H24N6O3S/c1-2-29-19-12-11-17(33(31,32)28-13-7-4-8-14-28)15-18(19)20-21(29)24-23(27-26-20)25-22(30)16-9-5-3-6-10-16/h3,5-6,9-12,15H,2,4,7-8,13-14H2,1H3,(H,24,25,27,30) |
| InChIKey | KMTIMVOXQLKOKE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |