C17H12FN5O2 — CID 6417049
2-fluoro-N-(8-methoxy-5H-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide (PubChem CID 6417049) has the molecular formula C17H12FN5O2 and a molecular weight of 337.31 g/mol. Its IUPAC name is 2-fluoro-N-(8-methoxy-5H-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide.
| Compound Name | 2-fluoro-N-(8-methoxy-5H-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide |
|---|---|
| PubChem CID | 6417049 |
| Molecular Formula | C17H12FN5O2 |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 2-fluoro-N-(8-methoxy-5H-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide |
| SMILES | COc1ccc2[nH]c3nc(NC(=O)c4ccccc4F)nnc3c2c1 |
| InChI | InChI=1S/C17H12FN5O2/c1-25-9-6-7-13-11(8-9)14-15(19-13)20-17(23-22-14)21-16(24)10-4-2-3-5-12(10)18/h2-8H,1H3,(H2,19,20,21,23,24) |
| InChIKey | NCUCVPLVKIIHPQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |