C17H12FN5O — CID 6417050
4-fluoro-N-(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide (PubChem CID 6417050) has the molecular formula C17H12FN5O and a molecular weight of 321.32 g/mol. Its IUPAC name is 4-fluoro-N-(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide.
| Compound Name | 4-fluoro-N-(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide |
|---|---|
| PubChem CID | 6417050 |
| Molecular Formula | C17H12FN5O |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 4-fluoro-N-(8-methyl-5H-[1,2,4]triazino[5,6-b]indol-3-yl)benzamide |
| SMILES | Cc1ccc2[nH]c3nc(NC(=O)c4ccc(F)cc4)nnc3c2c1 |
| InChI | InChI=1S/C17H12FN5O/c1-9-2-7-13-12(8-9)14-15(19-13)20-17(23-22-14)21-16(24)10-3-5-11(18)6-4-10/h2-8H,1H3,(H2,19,20,21,23,24) |
| InChIKey | MOHXUQKFGJKRNO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |