C18H29NO6 — CID 6419692
(3S,10R,11S,15S)-11-methoxy-3,10-dimethyl-5,13-dioxa-1-azabicyclo[13.3.0]octadecane-2,6,14-trione (PubChem CID 6419692) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is (3S,10R,11S,15S)-11-methoxy-3,10-dimethyl-5,13-dioxa-1-azabicyclo[13.3.0]octadecane-2,6,14-trione.
| Compound Name | (3S,10R,11S,15S)-11-methoxy-3,10-dimethyl-5,13-dioxa-1-azabicyclo[13.3.0]octadecane-2,6,14-trione |
|---|---|
| PubChem CID | 6419692 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (3S,10R,11S,15S)-11-methoxy-3,10-dimethyl-5,13-dioxa-1-azabicyclo[13.3.0]octadecane-2,6,14-trione |
| SMILES | CO[C@@H]1COC(=O)[C@@H]2CCCN2C(=O)[C@@H](C)COC(=O)CCC[C@H]1C |
| InChI | InChI=1S/C18H29NO6/c1-12-6-4-8-16(20)24-10-13(2)17(21)19-9-5-7-14(19)18(22)25-11-15(12)23-3/h12-15H,4-11H2,1-3H3/t12-,13+,14+,15-/m1/s1 |
| InChIKey | FMHCXROILBDNAE-CBBWQLFWSA-N |
| XLogP | 1.53 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |