C15H24O2S — CID 6420995
5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 6420995) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-2,3-dihydrothiophene 1,1-dioxide.
| Compound Name | 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-2,3-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 6420995 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 5-[(2E)-3,7-dimethylocta-2,6-dienyl]-4-methyl-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | CC(C)=CCC/C(C)=C/CC1=C(C)CCS1(=O)=O |
| InChI | InChI=1S/C15H24O2S/c1-12(2)6-5-7-13(3)8-9-15-14(4)10-11-18(15,16)17/h6,8H,5,7,9-11H2,1-4H3/b13-8+ |
| InChIKey | HAVBKGDONLCLBG-MDWZMJQESA-N |
| XLogP | 4.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|