C14H22O5 — CID 6424873
4-(2-ethoxy-1,2-dimethoxyethyl)-1,2-dimethoxybenzene (PubChem CID 6424873) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is 4-(2-ethoxy-1,2-dimethoxyethyl)-1,2-dimethoxybenzene.
| Compound Name | 4-(2-ethoxy-1,2-dimethoxyethyl)-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 6424873 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 4-(2-ethoxy-1,2-dimethoxyethyl)-1,2-dimethoxybenzene |
| SMILES | CCOC(OC)C(OC)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C14H22O5/c1-6-19-14(18-5)13(17-4)10-7-8-11(15-2)12(9-10)16-3/h7-9,13-14H,6H2,1-5H3 |
| InChIKey | WBLUCXWAOXEWKV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|