C14H17NO3 — CID 6425248
(5-methoxy-1-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-9-yl) acetate (PubChem CID 6425248) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (5-methoxy-1-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-9-yl) acetate.
| Compound Name | (5-methoxy-1-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-9-yl) acetate |
|---|---|
| PubChem CID | 6425248 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (5-methoxy-1-azatricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-9-yl) acetate |
| SMILES | COc1ccc2c(c1)C1CCN2CC1OC(C)=O |
| InChI | InChI=1S/C14H17NO3/c1-9(16)18-14-8-15-6-5-11(14)12-7-10(17-2)3-4-13(12)15/h3-4,7,11,14H,5-6,8H2,1-2H3 |
| InChIKey | ABNFBBNFYFTWNW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|