About [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride
[6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride (PubChem CID 67869687) has the molecular formula C17H22ClNO3
and a molecular weight of 323.82 g/mol. Its IUPAC name is [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride.
Molecular Properties
| Compound Name | [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride |
| PubChem CID | 67869687 |
| Molecular Formula | C17H22ClNO3 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride |
| SMILES | COc1ccc(C2=CCN3CCC(OC(C)=O)C2C3)cc1.Cl |
| InChI | InChI=1S/C17H21NO3.ClH/c1-12(19)21-17-8-10-18-9-7-15(16(17)11-18)13-3-5-14(20-2)6-4-13;/h3-7,16-17H,8-11H2,1-2H3;1H |
| InChIKey | VWIDNGSSVRAGQL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride?
The IUPAC name of [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride (CID 67869687) is [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride.
What is the SMILES notation for [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride?
The canonical SMILES for [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride is COc1ccc(C2=CCN3CCC(OC(C)=O)C2C3)cc1.Cl.
What is the InChIKey of [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride?
The InChIKey is VWIDNGSSVRAGQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO3.ClH/c1-12(19)21-17-8-10-18-9-7-15(16(17)11-18)13-3-5-14(20-2)6-4-13;/h3-7,16-17H,8-11H2,1-2H3;1H.
What are the key properties of [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride?
[6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride has a molecular weight of 323.82 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(4-methoxyphenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] acetate;hydrochloride is sourced from PubChem (CID 67869687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).