C14H31NSi — CID 642577
N,N-dipropyl-3-(trimethylsilylmethyl)but-3-en-1-amine (PubChem CID 642577) has the molecular formula C14H31NSi and a molecular weight of 241.49 g/mol. Its IUPAC name is N,N-dipropyl-3-(trimethylsilylmethyl)but-3-en-1-amine.
| Compound Name | N,N-dipropyl-3-(trimethylsilylmethyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 642577 |
| Molecular Formula | C14H31NSi |
| Molecular Weight | 241.49 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | N,N-dipropyl-3-(trimethylsilylmethyl)but-3-en-1-amine |
| SMILES | C=C(CCN(CCC)CCC)C[Si](C)(C)C |
| InChI | InChI=1S/C14H31NSi/c1-7-10-15(11-8-2)12-9-14(3)13-16(4,5)6/h3,7-13H2,1-2,4-6H3 |
| InChIKey | LULIBCTXDCFAJE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|