C15H34O5Si3 — CID 6427156
(4S,5R)-5-[1,2-bis(trimethylsilyloxy)ethyl]-4-trimethylsilyloxyoxolan-2-one (PubChem CID 6427156) has the molecular formula C15H34O5Si3 and a molecular weight of 378.69 g/mol. Its IUPAC name is (4S,5R)-5-[1,2-bis(trimethylsilyloxy)ethyl]-4-trimethylsilyloxyoxolan-2-one.
| Compound Name | (4S,5R)-5-[1,2-bis(trimethylsilyloxy)ethyl]-4-trimethylsilyloxyoxolan-2-one |
|---|---|
| PubChem CID | 6427156 |
| Molecular Formula | C15H34O5Si3 |
| Molecular Weight | 378.69 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (4S,5R)-5-[1,2-bis(trimethylsilyloxy)ethyl]-4-trimethylsilyloxyoxolan-2-one |
| SMILES | C[Si](C)(C)OCC(O[Si](C)(C)C)[C@@H]1OC(=O)C[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C15H34O5Si3/c1-21(2,3)17-11-13(20-23(7,8)9)15-12(10-14(16)18-15)19-22(4,5)6/h12-13,15H,10-11H2,1-9H3/t12-,13?,15+/m0/s1 |
| InChIKey | RAZXAENPWHOWLE-RMTCENKZSA-N |
| XLogP | 3.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|