C15H24O2 — CID 6429051
(2E,5E)-3-methyl-6-(2-methyl-5-prop-1-en-2-yloxolan-2-yl)hexa-2,5-dien-1-ol (PubChem CID 6429051) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (2E,5E)-3-methyl-6-(2-methyl-5-prop-1-en-2-yloxolan-2-yl)hexa-2,5-dien-1-ol.
| Compound Name | (2E,5E)-3-methyl-6-(2-methyl-5-prop-1-en-2-yloxolan-2-yl)hexa-2,5-dien-1-ol |
|---|---|
| PubChem CID | 6429051 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (2E,5E)-3-methyl-6-(2-methyl-5-prop-1-en-2-yloxolan-2-yl)hexa-2,5-dien-1-ol |
| SMILES | C=C(C)C1CCC(C)(/C=C/C/C(C)=C/CO)O1 |
| InChI | InChI=1S/C15H24O2/c1-12(2)14-7-10-15(4,17-14)9-5-6-13(3)8-11-16/h5,8-9,14,16H,1,6-7,10-11H2,2-4H3/b9-5+,13-8+ |
| InChIKey | RHOFVSRBKFWSOJ-OKCSQZJQSA-N |
| XLogP | 3.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|