C10H8F6N4O2S2 — CID 6431785
N-[4,6-bis(methylsulfanyl)-2-[(2,2,2-trifluoroacetyl)amino]pyrimidin-5-yl]-2,2,2-trifluoroacetamide (PubChem CID 6431785) has the molecular formula C10H8F6N4O2S2 and a molecular weight of 394.32 g/mol. Its IUPAC name is N-[4,6-bis(methylsulfanyl)-2-[(2,2,2-trifluoroacetyl)amino]pyrimidin-5-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4,6-bis(methylsulfanyl)-2-[(2,2,2-trifluoroacetyl)amino]pyrimidin-5-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 6431785 |
| Molecular Formula | C10H8F6N4O2S2 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.00 |
| IUPAC Name | N-[4,6-bis(methylsulfanyl)-2-[(2,2,2-trifluoroacetyl)amino]pyrimidin-5-yl]-2,2,2-trifluoroacetamide |
| SMILES | CSc1nc(NC(=O)C(F)(F)F)nc(SC)c1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H8F6N4O2S2/c1-23-4-3(17-6(21)9(11,12)13)5(24-2)19-8(18-4)20-7(22)10(14,15)16/h1-2H3,(H,17,21)(H,18,19,20,22) |
| InChIKey | SGHUHUDAJDQDEL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |