C25H30ClNO6 — CID 6433652
2-[3-(4-chlorophenyl)butyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium;(Z)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 6433652) has the molecular formula C25H30ClNO6 and a molecular weight of 475.97 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)butyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium;(Z)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | 2-[3-(4-chlorophenyl)butyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium;(Z)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6433652 |
| Molecular Formula | C25H30ClNO6 |
| Molecular Weight | 475.97 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 2-[3-(4-chlorophenyl)butyl]-6,7-dimethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium;(Z)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | COc1cc2c(cc1OC)C[NH+](CCC(C)c1ccc(Cl)cc1)CC2.O=C([O-])/C=C\C(=O)O |
| InChI | InChI=1S/C21H26ClNO2.C4H4O4/c1-15(16-4-6-19(22)7-5-16)8-10-23-11-9-17-12-20(24-2)21(25-3)13-18(17)14-23;5-3(6)1-2-4(7)8/h4-7,12-13,15H,8-11,14H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | MHWJRYPPRWAZIT-BTJKTKAUSA-N |
| XLogP | 1.87 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.97 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|