C26H40N2O — CID 6434381
(9E,11E,13E)-N'-(2-phenylethyl)octadeca-9,11,13-trienehydrazide (PubChem CID 6434381) has the molecular formula C26H40N2O and a molecular weight of 396.62 g/mol. Its IUPAC name is (9E,11E,13E)-N'-(2-phenylethyl)octadeca-9,11,13-trienehydrazide.
| Compound Name | (9E,11E,13E)-N'-(2-phenylethyl)octadeca-9,11,13-trienehydrazide |
|---|---|
| PubChem CID | 6434381 |
| Molecular Formula | C26H40N2O |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | (9E,11E,13E)-N'-(2-phenylethyl)octadeca-9,11,13-trienehydrazide |
| SMILES | CCCC/C=C/C=C/C=C/CCCCCCCC(=O)NNCCc1ccccc1 |
| InChI | InChI=1S/C26H40N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-22-26(29)28-27-24-23-25-20-17-16-18-21-25/h5-10,16-18,20-21,27H,2-4,11-15,19,22-24H2,1H3,(H,28,29)/b6-5+,8-7+,10-9+ |
| InChIKey | CHAJPYJMHWMBSB-SUTYWZMXSA-N |
| XLogP | 6.44 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|